![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[ ]](/icons/layout.gif) | Ha - Master.pdf | 2025-09-04 15:24 | 9.0M | |
| Hampden County Inhabitants of.pdf | 2025-09-04 15:24 | 1.8M | |
| Hampden R R Corp.pdf | 2025-09-04 15:24 | 285K | |
| Harbor and Land Commissioners.pdf | 2025-09-04 15:24 | 208K | |
| Hampden Town.pdf | 2025-09-04 15:24 | 77K | |
| Hampden Meadow.pdf | 2025-09-04 15:24 | 58K | |
| Hafey, Nora.pdf | 2025-09-04 15:24 | 51K | |
| Hafey, Rosa.pdf | 2025-09-04 15:24 | 51K | |
| Hampden Meadow Corp.pdf | 2025-09-04 15:24 | 48K | |
| Haley, Brian N.pdf | 2025-09-04 15:24 | 47K | |
| Harbey, William.pdf | 2025-09-04 15:24 | 47K | |
| Hatheway-Steane Corporation.pdf | 2025-09-04 15:24 | 47K | |
| Hampden Heights or Hampden Heights Addition.pdf | 2025-09-04 15:24 | 44K | |
| Hamar Construction Co Inc.pdf | 2025-09-04 15:24 | 43K | |
| Hampden Gate Condominium.pdf | 2025-09-04 15:24 | 43K | |
| Hall, Philip H.pdf | 2025-09-04 15:24 | 39K | |
| Hall, Janice K.pdf | 2025-09-04 15:24 | 37K | |
| Haley, Thomas W.pdf | 2025-09-04 15:24 | 36K | |
| Hardy, Wendell.pdf | 2025-09-04 15:24 | 35K | |
| Haven, Martha J.pdf | 2025-09-04 15:24 | 33K | |
| Haven, Herman.pdf | 2025-09-04 15:24 | 33K | |
| Hamilton Park.pdf | 2025-09-04 15:24 | 30K | |
| Hastings Realty Trust trustees of.pdf | 2025-09-04 15:24 | 29K | |
| Hamilton Reservoir.pdf | 2025-09-04 15:24 | 29K | |
| Hampden-Hampshire Corporation.pdf | 2025-09-04 15:24 | 28K | |
| Hamberg, Hendrick.pdf | 2025-09-04 15:24 | 28K | |
| Hampden Heights.pdf | 2025-09-04 15:24 | 28K | |
| Harris, Earle H.pdf | 2025-09-04 15:24 | 27K | |
| Ham Hill Estates.pdf | 2025-09-04 15:24 | 26K | |
| Hall, Phillip.pdf | 2025-09-04 15:24 | 25K | |
| Hamilton Corp of Cambridge Inc.pdf | 2025-09-04 15:24 | 25K | |
| Hamilton West.pdf | 2025-09-04 15:24 | 25K | |
| Hayre, William A or Tr.pdf | 2025-09-04 15:24 | 25K | |
| Harris, Elmer L.pdf | 2025-09-04 15:24 | 25K | |
| Haluch, Theodore.pdf | 2025-09-04 15:24 | 24K | |
| Havenhurst Estates.pdf | 2025-09-04 15:24 | 24K | |
| Hartford & Conn Western R R Co.pdf | 2025-09-04 15:24 | 24K | |
| Hampden Builders.pdf | 2025-09-04 15:24 | 24K | |
| Hammerhead Construction Inc.pdf | 2025-09-04 15:24 | 24K | |
| Hathaway-Steane Corp.pdf | 2025-09-04 15:24 | 23K | |
| Hampden Brewing Co.pdf | 2025-09-04 15:24 | 23K | |
| Hawley, York & Locke (Hawley Locke & Brewer).pdf | 2025-09-04 15:24 | 23K | |
| Hampden Investment Corp.pdf | 2025-09-04 15:24 | 23K | |
| Hampden Color & Chemical Co.pdf | 2025-09-04 15:24 | 23K | |
| Hamilton East.pdf | 2025-09-04 15:24 | 23K | |
| Hallahan Custom Builders.pdf | 2025-09-04 15:24 | 23K | |
| Harrison Building Corporation.pdf | 2025-09-04 15:24 | 23K | |
| Hagerty, William M.pdf | 2025-09-04 15:24 | 23K | |
| Haviland Pond.pdf | 2025-09-04 15:24 | 23K | |
| Haller, Benjamin E.pdf | 2025-09-04 15:24 | 23K | |
| Hall, Robert.pdf | 2025-09-04 15:24 | 23K | |
| Hampden Council-Boy Scouts of America Inc.pdf | 2025-09-04 15:24 | 23K | |
| Hamberg, Sylvia F.pdf | 2025-09-04 15:24 | 22K | |
| Hall, Philip K.pdf | 2025-09-04 15:24 | 22K | |
| Hampden-Berkshire Tuberculosis & Respiratory Disease Assoc.pdf | 2025-09-04 15:24 | 22K | |
| Hamel, Kenneth H.pdf | 2025-09-04 15:24 | 22K | |
| Hammermill Paper Co (Old Colony Envelope Division).pdf | 2025-09-04 15:24 | 22K | |
| Hastings Heights.pdf | 2025-09-04 15:24 | 22K | |
| Hampden Glazed Paper & Card Co.pdf | 2025-09-04 15:24 | 22K | |
| Hardy, Marion.pdf | 2025-09-04 15:24 | 22K | |
| Hawley, N I &c.pdf | 2025-09-04 15:24 | 22K | |
| Haviland, J Est.pdf | 2025-09-04 15:24 | 21K | |
| Hampden Woods Associates.pdf | 2025-09-04 15:24 | 21K | |
| Hansen, John.pdf | 2025-09-04 15:24 | 21K | |
| Hanks, Stanley B.pdf | 2025-09-04 15:24 | 21K | |
| Hamilton Emery and Corundum Company.pdf | 2025-09-04 15:24 | 21K | |
| Hanks, Marjorie L.pdf | 2025-09-04 15:24 | 21K | |
| Hansen, Eugene W.pdf | 2025-09-04 15:24 | 21K | |
| Hampton Ponds.pdf | 2025-09-04 15:24 | 21K | |
| Harlow Royal Realty Inc.pdf | 2025-09-04 15:24 | 21K | |
| Haller, William.pdf | 2025-09-04 15:24 | 21K | |
| Hatch, Howard L.pdf | 2025-09-04 15:24 | 21K | |
| Hampden Hotel Company.pdf | 2025-09-04 15:24 | 21K | |
| Hampden East.pdf | 2025-09-04 15:24 | 21K | |
| Haas, Frederick W.pdf | 2025-09-04 15:24 | 21K | |
| Harrison, Samuel.pdf | 2025-09-04 15:24 | 21K | |
| Hammerhead Construction Co.pdf | 2025-09-04 15:24 | 20K | |
| Hampden-Glendale Associates.pdf | 2025-09-04 15:24 | 20K | |
| Hallahan, Fred.pdf | 2025-09-04 15:24 | 20K | |
| Hampden Heights Associates.pdf | 2025-09-04 15:24 | 20K | |
| Harrison, Helen.pdf | 2025-09-04 15:24 | 20K | |
| Haracz, Stanley.pdf | 2025-09-04 15:24 | 20K | |
| Hallbourg, Frank.pdf | 2025-09-04 15:24 | 20K | |
| Hall, Martha J.pdf | 2025-09-04 15:24 | 20K | |
| Haskins and Kimball.pdf | 2025-09-04 15:24 | 20K | |
| Hampden House Inc.pdf | 2025-09-04 15:24 | 20K | |
| Hartford Despatch & Warehouse Co Inc.pdf | 2025-09-04 15:24 | 20K | |
| Haas, Elsie I.pdf | 2025-09-04 15:24 | 20K | |
| Haas, Henry Albert.pdf | 2025-09-04 15:24 | 20K | |
| Hathaway, Marion H.pdf | 2025-09-04 15:24 | 20K | |
| Harry, Harold M.pdf | 2025-09-04 15:24 | 20K | |
| Hatch, Norman B.pdf | 2025-09-04 15:24 | 20K | |
| Hall, Jane O.pdf | 2025-09-04 15:24 | 19K | |
| Hampden Coal and Oil Co.pdf | 2025-09-04 15:24 | 19K | |
| Hatch, Janet B.pdf | 2025-09-04 15:24 | 19K | |
| Hamberg, Hendrick D.pdf | 2025-09-04 15:24 | 19K | |
| Hampden Woods.pdf | 2025-09-04 15:24 | 19K | |
| Hall, William F Jr.pdf | 2025-09-04 15:24 | 19K | |
| Harrington, Margaret M &c.pdf | 2025-09-04 15:24 | 19K | |
| Haddock, Samuel W.pdf | 2025-09-04 15:24 | 19K | |
| Hartford and Worcester St Rwy Co.pdf | 2025-09-04 15:24 | 19K | |
| Hatch, D Kent.pdf | 2025-09-04 15:24 | 19K | |
| Hackett, Betty Ann.pdf | 2025-09-04 15:24 | 19K | |
| Hampden Fence Supply Inc.pdf | 2025-09-04 15:24 | 19K | |
| Hayden, Minnie L &c.pdf | 2025-09-04 15:24 | 19K | |
| Hannover Healthcare - Massachusetts Inc.pdf | 2025-09-04 15:24 | 19K | |
| Hayden, William H &c.pdf | 2025-09-04 15:24 | 19K | |
| Harrington, John T &c.pdf | 2025-09-04 15:24 | 19K | |
| Haller, Malleville E.pdf | 2025-09-04 15:24 | 19K | |
| Hampshire Brick Co.pdf | 2025-09-04 15:24 | 19K | |
| Hampden County Jail & House of Correction.pdf | 2025-09-04 15:24 | 19K | |
| Harry, Anna S.pdf | 2025-09-04 15:24 | 19K | |
| Haley, Brian.pdf | 2025-09-04 15:24 | 19K | |
| Hampden Country Club.pdf | 2025-09-04 15:24 | 19K | |
| Harbey, William J.pdf | 2025-09-04 15:24 | 19K | |
| Hampden-Glendale Associates Inc.pdf | 2025-09-04 15:24 | 19K | |
| Hammersley, H W.pdf | 2025-09-04 15:24 | 19K | |
| Hanchett, Frederick N.pdf | 2025-09-04 15:24 | 19K | |
| Hartshorn, Elinor C.pdf | 2025-09-04 15:24 | 19K | |
| Harvey, Ernestine L.pdf | 2025-09-04 15:24 | 19K | |
| Habitat- St James Ave Condominium.pdf | 2025-09-04 15:24 | 19K | |
| Hamblen, Edward H &c trs.pdf | 2025-09-04 15:24 | 19K | |
| Hartford Electric Light Co.pdf | 2025-09-04 15:24 | 19K | |
| Hanna, Janet A.pdf | 2025-09-04 15:24 | 19K | |
| Hammer, Henry F.pdf | 2025-09-04 15:24 | 19K | |
| Haskell and Smith.pdf | 2025-09-04 15:24 | 18K | |
| Hawley, Edwin L.pdf | 2025-09-04 15:24 | 18K | |
| Haven Heights.pdf | 2025-09-04 15:24 | 18K | |
| Hall, David.pdf | 2025-09-04 15:24 | 18K | |
| Harvey, Foster E &c.pdf | 2025-09-04 15:24 | 18K | |
| Hawley Dorman & Hawley.pdf | 2025-09-04 15:24 | 18K | |
| Happy Acres.pdf | 2025-09-04 15:24 | 18K | |
| Hall, Roger A.pdf | 2025-09-04 15:24 | 18K | |
| Hardie, Richard D.pdf | 2025-09-04 15:24 | 18K | |
| Hampden Steam Plant Property.pdf | 2025-09-04 15:24 | 18K | |
| Haley, Elizabeth L.pdf | 2025-09-04 15:24 | 18K | |
| Hanna, Robert L.pdf | 2025-09-04 15:24 | 18K | |
| Harvey.pdf | 2025-09-04 15:24 | 18K | |
| Harvey, N M tr.pdf | 2025-09-04 15:24 | 18K | |
| Hallahan, Fred C Jr.pdf | 2025-09-04 15:24 | 18K | |
| Haley, Carolyn A.pdf | 2025-09-04 15:24 | 18K | |
| Haney, Alexander.pdf | 2025-09-04 15:24 | 18K | |
| Hardee's Food Systems Inc.pdf | 2025-09-04 15:24 | 18K | |
| Hafey Funeral Service Inc.pdf | 2025-09-04 15:24 | 18K | |
| Hamilton, Alice.pdf | 2025-09-04 15:24 | 18K | |
| Hackett, John L.pdf | 2025-09-04 15:24 | 18K | |
| Harris, Bruce E.pdf | 2025-09-04 15:24 | 18K | |
| Hannoush Family Trust.pdf | 2025-09-04 15:24 | 18K | |
| Harris, Frederick &c.pdf | 2025-09-04 15:24 | 18K | |
| Hansen, Myrtle F.pdf | 2025-09-04 15:24 | 18K | |
| Hanechuk, Joseph A.pdf | 2025-09-04 15:24 | 18K | |
| Hawk Enterprises.pdf | 2025-09-04 15:24 | 18K | |
| Hamilton, Mary A Estate.pdf | 2025-09-04 15:24 | 18K | |
| Hawley, Marion E.pdf | 2025-09-04 15:24 | 18K | |
| Harnois, Israel.pdf | 2025-09-04 15:24 | 18K | |
| Haynes Realty Trust.pdf | 2025-09-04 15:24 | 18K | |
| Hamel, Stanley A.pdf | 2025-09-04 15:24 | 18K | |
| Haley, Anne S.pdf | 2025-09-04 15:24 | 18K | |
| Hall, Julius B est.pdf | 2025-09-04 15:24 | 18K | |
| Harvard Park.pdf | 2025-09-04 15:24 | 18K | |
| Hampden East Condominium.pdf | 2025-09-04 15:24 | 18K | |
| Hamilton Abrasive Co &c.pdf | 2025-09-04 15:24 | 18K | |
| Hammer, Judith R.pdf | 2025-09-04 15:24 | 18K | |
| Hamel, Roland A.pdf | 2025-09-04 15:24 | 18K | |
| Hampden Savings Bank.pdf | 2025-09-04 15:24 | 18K | |
| Hamblen, E H TR & R L.pdf | 2025-09-04 15:24 | 18K | |
| Hammarstrom, David W.pdf | 2025-09-04 15:24 | 18K | |
| Harris, Judith A.pdf | 2025-09-04 15:24 | 18K | |
| Hamel, Esther B &c.pdf | 2025-09-04 15:24 | 18K | |
| Harrington, D J & J T.pdf | 2025-09-04 15:24 | 18K | |
| Haluch, Mary Estate.pdf | 2025-09-04 15:24 | 18K | |
| Harrison, Charles H.pdf | 2025-09-04 15:24 | 18K | |
| Harrison, Dolores C.pdf | 2025-09-04 15:24 | 18K | |
| Hayword, Roberta.pdf | 2025-09-04 15:24 | 18K | |
| Hannoush, Souad.pdf | 2025-09-04 15:24 | 18K | |
| Hannoush Estates.pdf | 2025-09-04 15:24 | 18K | |
| Harrison, Charles.pdf | 2025-09-04 15:24 | 18K | |
| Haney, Eleanor.pdf | 2025-09-04 15:24 | 18K | |
| Hajosy, William A.pdf | 2025-09-04 15:24 | 18K | |
| Hansen, Elizabeth A.pdf | 2025-09-04 15:24 | 18K | |
| Hamilton Lakelands.pdf | 2025-09-04 15:24 | 18K | |
| Hallmark, Benjamin.pdf | 2025-09-04 15:24 | 18K | |
| Hanson, Herbert C.pdf | 2025-09-04 15:24 | 18K | |
| Hampden Paint & Chemical Co.pdf | 2025-09-04 15:24 | 18K | |
| Harrison, Ernest.pdf | 2025-09-04 15:24 | 18K | |
| Hansen, Frances E.pdf | 2025-09-04 15:24 | 18K | |
| Hayden Wire Works Inc.pdf | 2025-09-04 15:24 | 18K | |
| Hampden Villa.pdf | 2025-09-04 15:24 | 18K | |
| Hall, William G.pdf | 2025-09-04 15:24 | 18K | |
| Hampden Distributing & Warehouse Center Inc.pdf | 2025-09-04 15:24 | 18K | |
| Hayden, Robert E.pdf | 2025-09-04 15:24 | 18K | |
| Hamel, Marie M.pdf | 2025-09-04 15:24 | 18K | |
| Haynes, Robert S.pdf | 2025-09-04 15:24 | 18K | |
| Hawley, Luther.pdf | 2025-09-04 15:24 | 18K | |
| Harley Company.pdf | 2025-09-04 15:24 | 18K | |
| Hardesty, John R.pdf | 2025-09-04 15:24 | 18K | |
| Hamilton, Lillian.pdf | 2025-09-04 15:24 | 18K | |
| Hallman, David M.pdf | 2025-09-04 15:24 | 18K | |
| Hampden County Commissioners.pdf | 2025-09-04 15:24 | 18K | |
| Hatton, William B Jr.pdf | 2025-09-04 15:24 | 18K | |
| Haselton and Williams.pdf | 2025-09-04 15:24 | 18K | |
| Hampden Real Estate Trust.pdf | 2025-09-04 15:24 | 18K | |
| Harrington, M M &c.pdf | 2025-09-04 15:24 | 18K | |
| Harvey, Anne M.pdf | 2025-09-04 15:24 | 18K | |
| Haraty, Donald E.pdf | 2025-09-04 15:24 | 18K | |
| Hansen, Harlon R.pdf | 2025-09-04 15:24 | 18K | |
| Harmon Grove Realty Tr.pdf | 2025-09-04 15:24 | 17K | |
| Hamilton, Lillian R.pdf | 2025-09-04 15:24 | 17K | |
| Harty, Evelyeen M.pdf | 2025-09-04 15:24 | 17K | |
| Harrell, Amelia C.pdf | 2025-09-04 15:24 | 17K | |
| Hampden Housing Authority.pdf | 2025-09-04 15:24 | 17K | |
| Hamdan, Hussein M.pdf | 2025-09-04 15:24 | 17K | |
| Hansen Real Estate Trust of 1980.pdf | 2025-09-04 15:24 | 17K | |
| Hartman, Anthony J.pdf | 2025-09-04 15:24 | 17K | |
| Hampden Nurseries Inc.pdf | 2025-09-04 15:24 | 17K | |
| Hathorne, George &c.pdf | 2025-09-04 15:24 | 17K | |
| Hammond, David H &c.pdf | 2025-09-04 15:24 | 17K | |
| Hastings, John H.pdf | 2025-09-04 15:24 | 17K | |
| Hastings, C W.pdf | 2025-09-04 15:24 | 17K | |
| Hathaway, John M.pdf | 2025-09-04 15:24 | 17K | |
| Hastings, Elsie G.pdf | 2025-09-04 15:24 | 17K | |
| Hartford Terrace.pdf | 2025-09-04 15:24 | 17K | |
| Hansen, Suzanne.pdf | 2025-09-04 15:24 | 17K | |
| Hallock, Barbara C.pdf | 2025-09-04 15:24 | 17K | |
| Hart, Richard C.pdf | 2025-09-04 15:24 | 17K | |
| Hawrhorne, Margaret trustee.pdf | 2025-09-04 15:24 | 17K | |
| Harper, Vincent P.pdf | 2025-09-04 15:24 | 17K | |
| Harrington, J T &C.pdf | 2025-09-04 15:24 | 17K | |
| Hamblen E Harold &c Trs.pdf | 2025-09-04 15:24 | 17K | |
| Hart, Luke.pdf | 2025-09-04 15:24 | 17K | |
| Hanscomb, George S.pdf | 2025-09-04 15:24 | 17K | |
| Harness, Lewis.pdf | 2025-09-04 15:24 | 17K | |
| Hammond, Frank G.pdf | 2025-09-04 15:24 | 17K | |
| Hancock, Ethan.pdf | 2025-09-04 15:24 | 17K | |
| Hayward, Caroline L.pdf | 2025-09-04 15:24 | 17K | |
| Harrison, Dolores.pdf | 2025-09-04 15:24 | 17K | |
| Harty, Joseph A.pdf | 2025-09-04 15:24 | 17K | |
| Hallman, Marilyn P.pdf | 2025-09-04 15:24 | 17K | |
| Hanks, Kenneth C.pdf | 2025-09-04 15:24 | 17K | |
| Hayre, Annie Est.pdf | 2025-09-04 15:24 | 17K | |
| Harrell, James E Jr.pdf | 2025-09-04 15:24 | 17K | |
| Harris, Steve D.pdf | 2025-09-04 15:24 | 17K | |
| Harmony Lodge No 140 I B P O E Of W Iinc.pdf | 2025-09-04 15:24 | 17K | |
| Hart, Marshall A.pdf | 2025-09-04 15:24 | 17K | |
| Hastings, Allis & Co.pdf | 2025-09-04 15:24 | 17K | |
| Hanechak, Raymond J.pdf | 2025-09-04 15:24 | 17K | |
| Handford, Lugrone.pdf | 2025-09-04 15:24 | 17K | |
| Hawley, Rollin L.pdf | 2025-09-04 15:24 | 17K | |
| Haraty, Peggy Ann.pdf | 2025-09-04 15:24 | 17K | |
| Haymarket Square.pdf | 2025-09-04 15:24 | 17K | |
| Hardie, Barbara M.pdf | 2025-09-04 15:24 | 17K | |
| Haracz, Wladyslawa.pdf | 2025-09-04 15:24 | 17K | |
| Hastings - Heirs.pdf | 2025-09-04 15:24 | 17K | |
| Hamilton, Jennie B.pdf | 2025-09-04 15:24 | 17K | |
| Harper, Alice.pdf | 2025-09-04 15:24 | 17K | |
| Harris Park.pdf | 2025-09-04 15:24 | 17K | |
| Haynes Hotel Basement.pdf | 2025-09-04 15:24 | 17K | |
| Hayes, Edith J.pdf | 2025-09-04 15:24 | 17K | |
| Harrington, Lorraine V.pdf | 2025-09-04 15:24 | 17K | |
| Harvey-Warriner.pdf | 2025-09-04 15:24 | 17K | |
| Hassler, C W.pdf | 2025-09-04 15:24 | 17K | |
| Harrington, William T.pdf | 2025-09-04 15:24 | 17K | |
| Hadley Falls Trust Company.pdf | 2025-09-04 15:24 | 17K | |
| Hastings C W & Co.pdf | 2025-09-04 15:24 | 17K | |
| Hampden Terraces.pdf | 2025-09-04 15:24 | 17K | |
| Hammersmith, Donald N.pdf | 2025-09-04 15:24 | 17K | |
| Harnish, Richard W.pdf | 2025-09-04 15:24 | 17K | |
| Hansen, Blanche.pdf | 2025-09-04 15:24 | 17K | |
| Harvey, Louise M.pdf | 2025-09-04 15:24 | 17K | |
| Hastings, Gladys A.pdf | 2025-09-04 15:24 | 17K | |
| Hampton Court.pdf | 2025-09-04 15:24 | 17K | |
| Hall, Andrew J &c.pdf | 2025-09-04 15:24 | 17K | |
| Hano Realty Trust.pdf | 2025-09-04 15:24 | 17K | |
| Hart, Patrick.pdf | 2025-09-04 15:24 | 17K | |
| Hartt, Dudley N Jr.pdf | 2025-09-04 15:24 | 17K | |
| Haracz, Jessie L.pdf | 2025-09-04 15:24 | 17K | |
| Hathaway, Doris M.pdf | 2025-09-04 15:24 | 17K | |
| Hansen, Francis W.pdf | 2025-09-04 15:24 | 17K | |
| Harrington, James E.pdf | 2025-09-04 15:24 | 17K | |
| Hannan Company.pdf | 2025-09-04 15:24 | 17K | |
| Hamlin, G H &c.pdf | 2025-09-04 15:24 | 17K | |
| Hansen, Harold E deceased.pdf | 2025-09-04 15:24 | 17K | |
| Harlow, Elizabeth P.pdf | 2025-09-04 15:24 | 17K | |
| Hallock, Howard H.pdf | 2025-09-04 15:24 | 17K | |
| Hartman, Joan C.pdf | 2025-09-04 15:24 | 17K | |
| Hartman, Harold R.pdf | 2025-09-04 15:24 | 17K | |
| Hawkins, Jack V.pdf | 2025-09-04 15:24 | 17K | |
| Hamilton, C W.pdf | 2025-09-04 15:24 | 17K | |
| Harris, Eileen M.pdf | 2025-09-04 15:24 | 17K | |
| Harbey, Joseph R.pdf | 2025-09-04 15:24 | 17K | |
| Harris, Roger B.pdf | 2025-09-04 15:24 | 17K | |
| Hansen, Mary E.pdf | 2025-09-04 15:24 | 17K | |
| Hammersmith, Jane A.pdf | 2025-09-04 15:24 | 17K | |
| Harris, Thomas A.pdf | 2025-09-04 15:24 | 17K | |
| Haracz, Martin.pdf | 2025-09-04 15:24 | 17K | |
| Hatch, Adrian H &c.pdf | 2025-09-04 15:24 | 17K | |
| Hayes, Robert.pdf | 2025-09-04 15:24 | 17K | |
| Haynes, (Mrs) Lyman.pdf | 2025-09-04 15:24 | 17K | |
| Haley, Todd C.pdf | 2025-09-04 15:24 | 17K | |
| Hampden Fields.pdf | 2025-09-04 15:24 | 17K | |
| Hart, Mary T.pdf | 2025-09-04 15:24 | 17K | |
| Hammond, Sadie &c.pdf | 2025-09-04 15:24 | 17K | |
| Hano, George.pdf | 2025-09-04 15:24 | 17K | |
| Harold Kent Ford Inc.pdf | 2025-09-04 15:24 | 17K | |
| Hanscom, Joyce E.pdf | 2025-09-04 15:24 | 17K | |
| Harley, L J Jr.pdf | 2025-09-04 15:24 | 17K | |
| Harris, Fred F.pdf | 2025-09-04 15:24 | 17K | |
| Hawks, Sheila.pdf | 2025-09-04 15:24 | 17K | |
| Harris, Martha.pdf | 2025-09-04 15:24 | 17K | |
| Harris, Austin K.pdf | 2025-09-04 15:24 | 17K | |
| Hart, Madeline B.pdf | 2025-09-04 15:24 | 17K | |
| Handyside, Melvina.pdf | 2025-09-04 15:24 | 17K | |
| Hayden, R W.pdf | 2025-09-04 15:24 | 17K | |
| Harry & Lillian Freedman Rlty Trust.pdf | 2025-09-04 15:24 | 17K | |
| Hamilton-Lizak, Linda J.pdf | 2025-09-04 15:24 | 17K | |
| Hadwen, Stuart A.pdf | 2025-09-04 15:24 | 17K | |
| Haynes, Ezra T.pdf | 2025-09-04 15:24 | 17K | |
| Hamelin, Gerald.pdf | 2025-09-04 15:24 | 17K | |
| Harnish, Marion.pdf | 2025-09-04 15:24 | 17K | |
| Handy, Herbert L &c.pdf | 2025-09-04 15:24 | 17K | |
| Hays, Russell A.pdf | 2025-09-04 15:24 | 17K | |
| Hahn, Gustave Estate.pdf | 2025-09-04 15:24 | 17K | |
| Hatch, Edward B.pdf | 2025-09-04 15:24 | 17K | |
| Hansen, Peter.pdf | 2025-09-04 15:24 | 17K | |
| Hawk, Ricky.pdf | 2025-09-04 15:24 | 17K | |
| Hayden, Stuart.pdf | 2025-09-04 15:24 | 17K | |
| Haas, Esther B.pdf | 2025-09-04 15:24 | 17K | |
| Hansen, Blanche A.pdf | 2025-09-04 15:24 | 17K | |
| Harrington, John T Jr.pdf | 2025-09-04 15:24 | 17K | |
| Hanuszczyk, Jan.pdf | 2025-09-04 15:24 | 17K | |
| Hardie, Gordon T.pdf | 2025-09-04 15:24 | 17K | |
| Hartig, Edward.pdf | 2025-09-04 15:24 | 17K | |
| Hamel, Stella.pdf | 2025-09-04 15:24 | 17K | |
| Haley, Nancy.pdf | 2025-09-04 15:24 | 17K | |
| Hastings, Lawrence.pdf | 2025-09-04 15:24 | 17K | |
| Hart, Rodney.pdf | 2025-09-04 15:24 | 17K | |
| Hass, Edward R.pdf | 2025-09-04 15:24 | 17K | |
| Harris Heights.pdf | 2025-09-04 15:24 | 17K | |
| Hallahan Custom Builders of Chicopee.pdf | 2025-09-04 15:24 | 17K | |
| Hartwig, Emma G.pdf | 2025-09-04 15:24 | 17K | |
| Harper, William J.pdf | 2025-09-04 15:24 | 17K | |
| Hartig, Frederick &c.pdf | 2025-09-04 15:24 | 17K | |
| Harris & Birnie.pdf | 2025-09-04 15:24 | 17K | |
| Hayden, Carolea.pdf | 2025-09-04 15:24 | 17K | |
| Haskins, Frederick E Jr.pdf | 2025-09-04 15:24 | 17K | |
| Hano Realty Inc.pdf | 2025-09-04 15:24 | 17K | |
| Harlow, Ward H.pdf | 2025-09-04 15:24 | 17K | |
| Hartshorn, James W S Jr.pdf | 2025-09-04 15:24 | 17K | |
| Haluch, Thomas.pdf | 2025-09-04 15:24 | 17K | |
| Hays, Gustavus I &c.pdf | 2025-09-04 15:24 | 17K | |
| Harvey, Stewart K.pdf | 2025-09-04 15:24 | 17K | |
| Hanson, Donald R.pdf | 2025-09-04 15:24 | 17K | |
| Hays, Nancy A.pdf | 2025-09-04 15:24 | 17K | |
| Hastings Crossing.pdf | 2025-09-04 15:24 | 17K | |
| Handzel, John M.pdf | 2025-09-04 15:24 | 17K | |
| Han-Con Inc.pdf | 2025-09-04 15:24 | 17K | |
| Haluck, Casimir.pdf | 2025-09-04 15:24 | 17K | |
| Hamel, Francis.pdf | 2025-09-04 15:24 | 16K | |
| Hadley Mills.pdf | 2025-09-04 15:24 | 16K | |
| Hanechak, John S.pdf | 2025-09-04 15:24 | 16K | |
| Hayden, Richard.pdf | 2025-09-04 15:24 | 16K | |
| Handzel, Laurie A.pdf | 2025-09-04 15:24 | 16K | |
| Hammerle, John R.pdf | 2025-09-04 15:24 | 16K | |
| Hawkins, Gloria J.pdf | 2025-09-04 15:24 | 16K | |
| Haynes, Tilly.pdf | 2025-09-04 15:24 | 16K | |
| Hansen, Ruth L.pdf | 2025-09-04 15:24 | 16K | |
| Haskins, Daniel P.pdf | 2025-09-04 15:24 | 16K | |
| Hayden, Mabel B.pdf | 2025-09-04 15:24 | 16K | |
| Hansen, John M.pdf | 2025-09-04 15:24 | 16K | |
| Harmon Wood & Co.pdf | 2025-09-04 15:24 | 16K | |
| Hawkins, Mary.pdf | 2025-09-04 15:24 | 16K | |
| Hartman, Cynthia J.pdf | 2025-09-04 15:24 | 16K | |
| Hart, Francis J.pdf | 2025-09-04 15:24 | 16K | |
| Hawkins, Robert A.pdf | 2025-09-04 15:24 | 16K | |
| Hatch, A H.pdf | 2025-09-04 15:24 | 16K | |
| Hayden, Violet E.pdf | 2025-09-04 15:24 | 16K | |
| Hartwig, Rudolph F.pdf | 2025-09-04 15:24 | 16K | |
| Harp, Wendell C.pdf | 2025-09-04 15:24 | 16K | |
| Hansen, Kurt P.pdf | 2025-09-04 15:24 | 16K | |
| Hawley, Vernon.pdf | 2025-09-04 15:24 | 16K | |
| Hanks, Chester W.pdf | 2025-09-04 15:24 | 16K | |
| Hamilton, Bernard L Jr.pdf | 2025-09-04 15:24 | 16K | |
| Hardick, Alan C.pdf | 2025-09-04 15:24 | 16K | |
| Hatch, Paul B.pdf | 2025-09-04 15:24 | 16K | |
| Haley, James J.pdf | 2025-09-04 15:24 | 16K | |
| Hatch, Edith L &c.pdf | 2025-09-04 15:24 | 16K | |
| Hamberg, Marion L.pdf | 2025-09-04 15:24 | 16K | |
| Hagar, Archie F &c.pdf | 2025-09-04 15:24 | 16K | |
| Harris, Guy M.pdf | 2025-09-04 15:24 | 16K | |
| Haraghey, John H Jr.pdf | 2025-09-04 15:24 | 16K | |
| Handzel, Joseph F.pdf | 2025-09-04 15:24 | 16K | |
| Handzel, John.pdf | 2025-09-04 15:24 | 16K | |
| Hartland, Ella M.pdf | 2025-09-04 15:24 | 16K | |
| Halie Development Co.pdf | 2025-09-04 15:24 | 16K | |
| Hanson, Gail.pdf | 2025-09-04 15:24 | 16K | |
| Hammerich, Paul.pdf | 2025-09-04 15:24 | 16K | |
| Hartman, David A.pdf | 2025-09-04 15:24 | 16K | |
| Hall, Marion A.pdf | 2025-09-04 15:24 | 16K | |
| Hamberg, Donald A.pdf | 2025-09-04 15:24 | 16K | |
| Haight, Wilson.pdf | 2025-09-04 15:24 | 16K | |
| Hawthorne, Shirley.pdf | 2025-09-04 15:24 | 16K | |
| Haskell, Esther H &c.pdf | 2025-09-04 15:24 | 16K | |
| Hall, William.pdf | 2025-09-04 15:24 | 16K | |
| Hayden, Earl J.pdf | 2025-09-04 15:24 | 16K | |
| Harris Hazel Estates.pdf | 2025-09-04 15:24 | 16K | |
| Handzel, Patricia.pdf | 2025-09-04 15:24 | 16K | |
| Haarman G & Company.pdf | 2025-09-04 15:24 | 16K | |
| Hafner, Prudence.pdf | 2025-09-04 15:24 | 16K | |
| Ham Hill Developers Inc.pdf | 2025-09-04 15:24 | 16K | |
| Hayden, Elsie S.pdf | 2025-09-04 15:24 | 16K | |
| Hampden Park.pdf | 2025-09-04 15:24 | 16K | |
| Haley, Jame J.pdf | 2025-09-04 15:24 | 16K | |
| Haley, Kathleen E.pdf | 2025-09-04 15:24 | 16K | |
| Hall, Janice.pdf | 2025-09-04 15:24 | 16K | |
| Haller, William Jr.pdf | 2025-09-04 15:24 | 16K | |
| Haley, Michael.pdf | 2025-09-04 15:24 | 16K | |
| Hartley, George S Jr.pdf | 2025-09-04 15:24 | 16K | |
| Hall, John F.pdf | 2025-09-04 15:24 | 16K | |
| Hampden West.pdf | 2025-09-04 15:24 | 16K | |
| Habel, Douglas P.pdf | 2025-09-04 15:24 | 16K | |
| Hall, Ann T.pdf | 2025-09-04 15:24 | 16K | |
| Hamel, Thomas M.pdf | 2025-09-04 15:24 | 16K | |
| Haley, Daniel.pdf | 2025-09-04 15:24 | 16K | |
| Hatch, Paulien J.pdf | 2025-09-04 15:24 | 16K | |
| Hall, Jennie.pdf | 2025-09-04 15:24 | 16K | |
| Hayden, James.pdf | 2025-09-04 15:24 | 16K | |
| Haglund, Harold D.pdf | 2025-09-04 15:24 | 16K | |
| Hafey, Francis I.pdf | 2025-09-04 15:24 | 16K | |
| Haluch, Raymond.pdf | 2025-09-04 15:24 | 16K | |
| Habel, Pauline P.pdf | 2025-09-04 15:24 | 16K | |
| Haggerty, John J Jr.pdf | 2025-09-04 15:24 | 16K | |
| Haley, Stanley A.pdf | 2025-09-04 15:24 | 15K | |
| Hafey & Rigali.pdf | 2025-09-04 15:24 | 15K | |
| Haetinger, Richard.pdf | 2025-09-04 15:24 | 15K | |
| Haley, Thomas W Jr.pdf | 2025-09-04 15:24 | 15K | |
| Hale, Eleanor W.pdf | 2025-09-04 15:24 | 15K | |
| Hadley Falls Co.pdf | 2025-09-04 15:24 | 15K | |
| Halpern Woods.pdf | 2025-09-04 15:24 | 15K | |
| Hartley, Janet E.pdf | 2025-09-04 15:24 | 15K | |
| Hale, Charles F.pdf | 2025-09-04 15:24 | 15K | |
| Haggerty, Charles C.pdf | 2025-09-04 15:24 | 15K | |
| Haberman, Herman heirs.pdf | 2025-09-04 15:24 | 15K | |
| Halon, Helen V.pdf | 2025-09-04 15:24 | 15K | |
| Hall, Nancy Mcg.pdf | 2025-09-04 15:24 | 15K | |
| Hague, Thomas E.pdf | 2025-09-04 15:24 | 15K | |
| Halon, Farris.pdf | 2025-09-04 15:24 | 15K | |
| Haglund, Maureen.pdf | 2025-09-04 15:24 | 15K | |
| Hale, Doris L.pdf | 2025-09-04 15:24 | 15K | |
| Halon, Faris J.pdf | 2025-09-04 15:24 | 15K | |
| Hatch, Doris S.pdf | 2025-09-04 15:24 | 15K | |
| Haviland Heights.pdf | 2025-09-04 15:24 | 15K | |
| Hagen, Daniel.pdf | 2025-09-04 15:24 | 15K | |
| Hansen, Fred.pdf | 2025-09-04 15:24 | 15K | |
| Hamel, Cecilia.pdf | 2025-09-04 15:24 | 15K | |
| Hagen, Susan.pdf | 2025-09-04 15:24 | 15K | |
| Halon, Edward.pdf | 2025-09-04 15:24 | 15K | |
| Haley, John.pdf | 2025-09-04 15:24 | 15K | |
| Haberman, Herman.pdf | 2025-09-04 15:24 | 15K | |
| Haggarty, Rob Roy.pdf | 2025-09-04 15:24 | 15K | |
| Hague, Richard.pdf | 2025-09-04 15:24 | 15K | |
| Hall, Catherine &c.pdf | 2025-09-04 15:24 | 15K | |
| Hale, D F.pdf | 2025-09-04 15:24 | 15K | |
| Habel, Marcel C.pdf | 2025-09-04 15:24 | 15K | |
| Hassapelis, John.pdf | 2025-09-04 15:24 | 15K | |
| Hassapelis, Marie.pdf | 2025-09-04 15:24 | 15K | |
| Hackney, Hazel.pdf | 2025-09-04 15:24 | 15K | |
| Haas, Mary A.pdf | 2025-09-04 15:24 | 15K | |
| Halpern, Samuel.pdf | 2025-09-04 15:24 | 15K | |
| Hall, O L.pdf | 2025-09-04 15:24 | 15K | |
| Hall Development Trust.pdf | 2025-09-04 15:24 | 15K | |
| Hatch, Ralph B.pdf | 2025-09-04 15:24 | 15K | |
| Halon, Fred.pdf | 2025-09-04 15:24 | 15K | |
| Haley, Judith A.pdf | 2025-09-04 15:24 | 15K | |
| Hagberg, Richard.pdf | 2025-09-04 15:24 | 15K | |
| Haley, Frank.pdf | 2025-09-04 15:24 | 15K | |
| Hager, Wilbert Sr.pdf | 2025-09-04 15:24 | 15K | |
| Hadley, Edward G.pdf | 2025-09-04 15:24 | 15K | |
| Hall, Anna V.pdf | 2025-09-04 15:24 | 15K | |
| Haley, David.pdf | 2025-09-04 15:24 | 15K | |
| Haley, Richard J Jr.pdf | 2025-09-04 15:24 | 15K | |
| Haley, David B.pdf | 2025-09-04 15:24 | 14K | |
| Hall, Lyman H.pdf | 2025-09-04 15:24 | 14K | |
| Hague, Alfred J Jr.pdf | 2025-09-04 15:24 | 14K | |
| Hall, Perry E.pdf | 2025-09-04 15:24 | 14K | |
| Habiger, Catherine.pdf | 2025-09-04 15:24 | 14K | |
| Hachadourian, Alfred.pdf | 2025-09-04 15:24 | 14K | |
| Habiger, Ronald W.pdf | 2025-09-04 15:24 | 14K | |
| Hadley Co.pdf | 2025-09-04 15:24 | 14K | |
| Hasbrook, W.pdf | 2025-09-04 15:24 | 14K | |
| Hasbrook, F.pdf | 2025-09-04 15:24 | 14K | |
| Hall, Robert W.pdf | 2025-09-04 15:24 | 14K | |
| Haberman, Morton A.pdf | 2025-09-04 15:24 | 13K | |
|
|---|