![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[ ]](/icons/layout.gif) | Chwalek, J &c.pdf | 2025-09-04 15:23 | 18K | |
| Churchill, Charles H est.pdf | 2025-09-04 15:23 | 19K | |
| Churchill, Ada.pdf | 2025-09-04 15:23 | 18K | |
| Churchill Estates.pdf | 2025-09-04 15:23 | 22K | |
| Churchill Industries Mass Inc.pdf | 2025-09-04 15:23 | 18K | |
| Church, Merle R.pdf | 2025-09-04 15:23 | 17K | |
| Church of the Epiphany.pdf | 2025-09-04 15:23 | 16K | |
| Church of the Christian Crusade Inc.pdf | 2025-09-04 15:23 | 18K | |
| Church of Christ.pdf | 2025-09-04 15:23 | 16K | |
| Church In the Acres.pdf | 2025-09-04 15:23 | 20K | |
| Chunglo, Marilyn I.pdf | 2025-09-04 15:23 | 17K | |
| Chunglo, Charles F.pdf | 2025-09-04 15:23 | 17K | |
| Chudy, John C.pdf | 2025-09-04 15:23 | 18K | |
| Chrzanowski, John W.pdf | 2025-09-04 15:23 | 16K | |
| Chrzan, Stanley.pdf | 2025-09-04 15:23 | 24K | |
| Chrzan, James.pdf | 2025-09-04 15:23 | 17K | |
| Chrysler Realty Corporation.pdf | 2025-09-04 15:23 | 18K | |
| Chrysler Realty Corp.pdf | 2025-09-04 15:23 | 17K | |
| Christopher, Thomas J.pdf | 2025-09-04 15:23 | 17K | |
| Christopher, Jennie M.pdf | 2025-09-04 15:23 | 19K | |
| Christopher, Albert J.pdf | 2025-09-04 15:23 | 19K | |
| Christo, Robert.pdf | 2025-09-04 15:23 | 22K | |
| Christianson, Arthur A.pdf | 2025-09-04 15:23 | 70K | |
| Christiansen, Gordon H.pdf | 2025-09-04 15:23 | 47K | |
| Christianson, Edward N.pdf | 2025-09-04 15:23 | 25K | |
| Christianson, Genevieve.pdf | 2025-09-04 15:23 | 18K | |
| Christian Crusade Church.pdf | 2025-09-04 15:23 | 18K | |
| Christian & Missionary Alliance Church of Westfield.pdf | 2025-09-04 15:23 | 19K | |
| Christenson, J A.pdf | 2025-09-04 15:23 | 18K | |
| Christ Lutheran Church.pdf | 2025-09-04 15:23 | 21K | |
| Christ Church.pdf | 2025-09-04 15:23 | 15K | |
| Chriscola's Farm Equipment Inc.pdf | 2025-09-04 15:23 | 18K | |
| Chretien, George L Sr.pdf | 2025-09-04 15:23 | 16K | |
| Chretien, Charles.pdf | 2025-09-04 15:23 | 18K | |
| Chouinard, Stephen W.pdf | 2025-09-04 15:23 | 18K | |
| Chouinard, Holly Lee.pdf | 2025-09-04 15:23 | 19K | |
| Chou, Shwee Tian.pdf | 2025-09-04 15:23 | 17K | |
| Choquette, Peter.pdf | 2025-09-04 15:23 | 16K | |
| Choquette, Enola.pdf | 2025-09-04 15:23 | 19K | |
| Choquette, Alfred.pdf | 2025-09-04 15:23 | 19K | |
| Choolgain, Kevork, G.pdf | 2025-09-04 15:23 | 20K | |
| Choiniere, Paul E.pdf | 2025-09-04 15:23 | 17K | |
| Choiniere, Norman A.pdf | 2025-09-04 15:23 | 20K | |
| Choiniere, Mary Est.pdf | 2025-09-04 15:23 | 19K | |
| Choiniere, Lena.pdf | 2025-09-04 15:23 | 21K | |
| Choiniere, Janet T.pdf | 2025-09-04 15:23 | 16K | |
| Choiniere, Charles.pdf | 2025-09-04 15:23 | 18K | |
| Choiniere, Amedee.pdf | 2025-09-04 15:23 | 18K | |
| Choiniere, A &c.pdf | 2025-09-04 15:23 | 20K | |
| Chmura, Ted.pdf | 2025-09-04 15:23 | 15K | |
| Chmura, Stephanie.pdf | 2025-09-04 15:23 | 18K | |
| Chmura, Stefan J.pdf | 2025-09-04 15:23 | 18K | |
| Chmura, Stanley E J.pdf | 2025-09-04 15:23 | 26K | |
| Chmura, Stanley.pdf | 2025-09-04 15:23 | 18K | |
| Chmura, Mitchell J S.pdf | 2025-09-04 15:23 | 20K | |
| Chmura, John.pdf | 2025-09-04 15:23 | 19K | |
| Chmura Circle.pdf | 2025-09-04 15:23 | 18K | |
| Chmiel, Janice.pdf | 2025-09-04 15:23 | 17K | |
| Chmiel, Peter.pdf | 2025-09-04 15:23 | 17K | |
| Chlastawa, Peter J.pdf | 2025-09-04 15:23 | 16K | |
| Chlastawa, Frank P.pdf | 2025-09-04 15:23 | 17K | |
| Chlastawa, Deborah A.pdf | 2025-09-04 15:23 | 17K | |
| Chiusamo, Karen.pdf | 2025-09-04 15:23 | 17K | |
| Chistolini, Joan A.pdf | 2025-09-04 15:23 | 17K | |
| Chistolini, Fioravanti F.pdf | 2025-09-04 15:23 | 18K | |
| Chisholm, Theodore H.pdf | 2025-09-04 15:23 | 20K | |
| Chiriko, Gerald S.pdf | 2025-09-04 15:23 | 16K | |
| Chipouras, Strati A.pdf | 2025-09-04 15:23 | 18K | |
| Chipman, Frank.pdf | 2025-09-04 15:23 | 20K | |
| Childs, S B.pdf | 2025-09-04 15:23 | 17K | |
| Childs, Otis.pdf | 2025-09-04 15:23 | 17K | |
| Chigos, Mary &c.pdf | 2025-09-04 15:23 | 18K | |
| Chigos, John &c.pdf | 2025-09-04 15:23 | 20K | |
| Chiginsky, George J.pdf | 2025-09-04 15:23 | 17K | |
| Chidley, J G.pdf | 2025-09-04 15:23 | 17K | |
| Chicopee Valley Aqueduct.pdf | 2025-09-04 15:23 | 63K | |
| Chicopee Water Works.pdf | 2025-09-04 15:23 | 21K | |
| Chicopee Turnpike Development Corp.pdf | 2025-09-04 15:23 | 22K | |
| Chicopee Street Gardens.pdf | 2025-09-04 15:23 | 19K | |
| Chicopee Development Trust Trustees of.pdf | 2025-09-04 15:23 | 20K | |
| Chicopee Savings Bank.pdf | 2025-09-04 15:23 | 24K | |
| Chicopee Redevelopment Authority.pdf | 2025-09-04 15:23 | 49K | |
| Chicopee Manufacturing Corporation of Company.pdf | 2025-09-04 15:23 | 85K | |
| Chicopee Municipal Credit Union.pdf | 2025-09-04 15:23 | 17K | |
| Chicopee City.pdf | 2025-09-04 15:23 | 3.1M | |
| Chicopee Lodge #1849 Benevolent and Protective Order of Elks.pdf | 2025-09-04 15:23 | 21K | |
| Chicopee Inn Associates.pdf | 2025-09-04 15:23 | 17K | |
| Chicopee Housing Authority.pdf | 2025-09-04 15:23 | 57K | |
| Chicopee Industries Mass Inc.pdf | 2025-09-04 15:23 | 20K | |
| Chicopee Grade Crossing.pdf | 2025-09-04 15:23 | 17K | |
| Chicopee Corporation - Inc.pdf | 2025-09-04 15:23 | 26K | |
| Chicopee Falls Building Co.pdf | 2025-09-04 15:23 | 22K | |
| Chicopee Falls Masonic Home Asso.pdf | 2025-09-04 15:23 | 19K | |
| Chicopee Electric Light Dept.pdf | 2025-09-04 15:23 | 21K | |
| Chicopee Congreation of Jehovah's Witness.pdf | 2025-09-04 15:23 | 20K | |
| Chicopee City of Engineering Department.pdf | 2025-09-04 15:23 | 23K | |
| Chicopee Bridge.pdf | 2025-09-04 15:23 | 17K | |
| Chicopee Bank & Trust Co.pdf | 2025-09-04 15:23 | 18K | |
| Chicoine, Susan E.pdf | 2025-09-04 15:23 | 16K | |
| Chicoine, Richard J.pdf | 2025-09-04 15:23 | 16K | |
| Chicofield Relaty Corporation.pdf | 2025-09-04 15:23 | 18K | |
| Chico Realty Trust.pdf | 2025-09-04 15:23 | 17K | |
| Chick, Joan.pdf | 2025-09-04 15:23 | 16K | |
| Chick, Joan T.pdf | 2025-09-04 15:23 | 17K | |
| Chick, Charles.pdf | 2025-09-04 15:23 | 16K | |
| Chick, Charles L Jr.pdf | 2025-09-04 15:23 | 17K | |
| Chiarizio, John A.pdf | 2025-09-04 15:23 | 17K | |
| Chiacchia, Stephen R.pdf | 2025-09-04 15:23 | 23K | |
| Chevalier, Jaquelyn M.pdf | 2025-09-04 15:23 | 17K | |
| Chevalier, Hazel E.pdf | 2025-09-04 15:23 | 17K | |
| Chevalier, Daniel R.pdf | 2025-09-04 15:23 | 17K | |
| Chetser Town.pdf | 2025-09-04 15:23 | 140K | |
| Chevalier, Arthur G Jr.pdf | 2025-09-04 15:23 | 17K | |
| Chestnut Orchard Lot.pdf | 2025-09-04 15:23 | 20K | |
| Chestnut Office Park Condominium.pdf | 2025-09-04 15:23 | 17K | |
| Chestnut House.pdf | 2025-09-04 15:23 | 16K | |
| Chester Village.pdf | 2025-09-04 15:23 | 16K | |
| Chester Vacation Farms.pdf | 2025-09-04 15:23 | 19K | |
| Chester Granite Quarries Inc.pdf | 2025-09-04 15:23 | 18K | |
| Chester Granite & Polishing Works.pdf | 2025-09-04 15:23 | 18K | |
| Chester Fire District in Chester.pdf | 2025-09-04 15:23 | 21K | |
| Chester and Becket R R.pdf | 2025-09-04 15:23 | 25K | |
| Chester and Blandford.pdf | 2025-09-04 15:23 | 17K | |
| Chesnicka, Joseph J.pdf | 2025-09-04 15:23 | 17K | |
| Chesky, Evelyn.pdf | 2025-09-04 15:23 | 18K | |
| Chesky, Carl.pdf | 2025-09-04 15:23 | 18K | |
| Chesbro, David.pdf | 2025-09-04 15:23 | 17K | |
| Cherry Lane Estates.pdf | 2025-09-04 15:23 | 16K | |
| Cherry Hill Estates.pdf | 2025-09-04 15:23 | 20K | |
| Cherry HIll Estates Annexation.pdf | 2025-09-04 15:23 | 16K | |
| Cherbonneau, Vincent.pdf | 2025-09-04 15:23 | 17K | |
| Chenier, Lillian A.pdf | 2025-09-04 15:23 | 52K | |
| Chenier, Richard G.pdf | 2025-09-04 15:23 | 22K | |
| Chenier, Laurence L.pdf | 2025-09-04 15:23 | 65K | |
| Cheney, Morine P.pdf | 2025-09-04 15:23 | 20K | |
| Cheney,David.pdf | 2025-09-04 15:23 | 17K | |
| Cheney, J William &c.pdf | 2025-09-04 15:23 | 22K | |
| Cheney, David Lee.pdf | 2025-09-04 15:23 | 17K | |
| Cheney, David L.pdf | 2025-09-04 15:23 | 16K | |
| Cheney-Bigelow Wire Works.pdf | 2025-09-04 15:23 | 27K | |
| Chenel and Mann.pdf | 2025-09-04 15:23 | 16K | |
| Chenaille, Francis L.pdf | 2025-09-04 15:23 | 19K | |
| Chenaille, Beverly A.pdf | 2025-09-04 15:23 | 17K | |
| Chemical Paper Manufacturing Corp.pdf | 2025-09-04 15:23 | 20K | |
| Chelkonas, Anthony J.pdf | 2025-09-04 15:23 | 16K | |
| Chelkonas, Margaret B.pdf | 2025-09-04 15:23 | 16K | |
| Cheika, Genevieve M.pdf | 2025-09-04 15:23 | 16K | |
| Chehade, Youssef B.pdf | 2025-09-04 15:23 | 21K | |
| Check, Stacy.pdf | 2025-09-04 15:23 | 18K | |
| Chechile, Anna Mae.pdf | 2025-09-04 15:23 | 17K | |
| Chavez, Maria G.pdf | 2025-09-04 15:23 | 16K | |
| Chavez, Jose A.pdf | 2025-09-04 15:23 | 16K | |
| Chaves, Manuel A.pdf | 2025-09-04 15:23 | 17K | |
| Chaves, John.pdf | 2025-09-04 15:23 | 17K | |
| Chaulox Realty Corp.pdf | 2025-09-04 15:23 | 17K | |
| Chattaway, Albert D &c.pdf | 2025-09-04 15:23 | 18K | |
| Chasteen, Eve.pdf | 2025-09-04 15:23 | 24K | |
| Chatel, Ronald A.pdf | 2025-09-04 15:23 | 16K | |
| Chateau Associates of Springfield.pdf | 2025-09-04 15:23 | 18K | |
| Chase, Richard A.pdf | 2025-09-04 15:23 | 17K | |
| Chase, Jane C.pdf | 2025-09-04 15:23 | 17K | |
| Chase, Howard C Jr.pdf | 2025-09-04 15:23 | 25K | |
| Chase, Eleanor F.pdf | 2025-09-04 15:23 | 17K | |
| Chase, David T.pdf | 2025-09-04 15:23 | 17K | |
| Chase, C P.pdf | 2025-09-04 15:23 | 19K | |
| Chase and Seyler Park.pdf | 2025-09-04 15:23 | 18K | |
| Chase - Seyler Realty Trust See E F Seyler.pdf | 2025-09-04 15:23 | 27K | |
| Charwick, Bruce J.pdf | 2025-09-04 15:23 | 16K | |
| Charvat, Walter.pdf | 2025-09-04 15:23 | 23K | |
| Charvat, Walter W.pdf | 2025-09-04 15:23 | 17K | |
| Charvat, Riota.pdf | 2025-09-04 15:23 | 24K | |
| Charvat, Riota M.pdf | 2025-09-04 15:23 | 17K | |
| Charvat, Daniel.pdf | 2025-09-04 15:23 | 17K | |
| Charvat, Daniel W.pdf | 2025-09-04 15:23 | 23K | |
| Chartier, Omer.pdf | 2025-09-04 15:23 | 18K | |
| Chartier, Cyril.pdf | 2025-09-04 15:23 | 24K | |
| Charter Oak Estates.pdf | 2025-09-04 15:23 | 18K | |
| Charron, Solange.pdf | 2025-09-04 15:23 | 25K | |
| Charron, Joseph W.pdf | 2025-09-04 15:23 | 25K | |
| Charron, David J.pdf | 2025-09-04 15:23 | 18K | |
| Charron, Arthur M.pdf | 2025-09-04 15:23 | 20K | |
| Charpentier, Raymond A.pdf | 2025-09-04 15:23 | 19K | |
| Charpentier, Margaret A.pdf | 2025-09-04 15:23 | 19K | |
| Charpentier, Jane A.pdf | 2025-09-04 15:23 | 17K | |
| Charpentier, Aime H.pdf | 2025-09-04 15:23 | 24K | |
| Charnella, Charles.pdf | 2025-09-04 15:23 | 16K | |
| Charnella, Adeline F.pdf | 2025-09-04 15:23 | 16K | |
| Charles Freihofer Baking Co.pdf | 2025-09-04 15:23 | 20K | |
| Charles Estate.pdf | 2025-09-04 15:23 | 17K | |
| Charles E Collins & Sons Incorporated.pdf | 2025-09-04 15:23 | 18K | |
| Charles Callahan Co Inc.pdf | 2025-09-04 15:23 | 18K | |
| Charles C Lewis Company.pdf | 2025-09-04 15:23 | 27K | |
| Charland, Joseph.pdf | 2025-09-04 15:23 | 15K | |
| Charkoudian, Toni A.pdf | 2025-09-04 15:23 | 17K | |
| Charkoudian, Harry N.pdf | 2025-09-04 15:23 | 18K | |
| Charkoudian, George K.pdf | 2025-09-04 15:23 | 17K | |
| Charkiewicz, Edward.pdf | 2025-09-04 15:23 | 17K | |
| Charista Real Estate Investment Inc.pdf | 2025-09-04 15:23 | 18K | |
| Charbonnet, William.pdf | 2025-09-04 15:23 | 17K | |
| Charbonneau, Joseph L.pdf | 2025-09-04 15:23 | 20K | |
| Charbonneau, Hormidas &c or Hormisdas.pdf | 2025-09-04 15:23 | 19K | |
| Charbonneau, David D.pdf | 2025-09-04 15:23 | 17K | |
| Char Drive Realty.pdf | 2025-09-04 15:23 | 20K | |
| Charbonneau, Augustin &c.pdf | 2025-09-04 15:23 | 18K | |
| Chapman, Parke A.pdf | 2025-09-04 15:23 | 20K | |
| Chapman, John.pdf | 2025-09-04 15:23 | 17K | |
| Chapman, Edith Est.pdf | 2025-09-04 15:23 | 17K | |
| Chapman, Donald.pdf | 2025-09-04 15:23 | 17K | |
| Chapman, Arthur W.pdf | 2025-09-04 15:23 | 16K | |
| Chapman, Ada J.pdf | 2025-09-04 15:23 | 17K | |
| Chapman Valve Manufacturing Company Inc.pdf | 2025-09-04 15:23 | 19K | |
| Chapman Realty Co Trustee of.pdf | 2025-09-04 15:23 | 17K | |
| Chaplin, G H.pdf | 2025-09-04 15:23 | 17K | |
| Chapin, Melba R.pdf | 2025-09-04 15:23 | 17K | |
| Chapin, Wesley A.pdf | 2025-09-04 15:23 | 20K | |
| Chapin, Samuel D.pdf | 2025-09-04 15:23 | 18K | |
| Chapin, Mable L Rivers.pdf | 2025-09-04 15:23 | 15K | |
| Chapin, Leslie A.pdf | 2025-09-04 15:23 | 21K | |
| Chapin, Greene.pdf | 2025-09-04 15:23 | 22K | |
| Chapin, Henry O.pdf | 2025-09-04 15:23 | 16K | |
| Chapin, Chester W (Heirs).pdf | 2025-09-04 15:23 | 16K | |
| Chapin, C W.pdf | 2025-09-04 15:23 | 16K | |
| Chapin, Barbara J.pdf | 2025-09-04 15:23 | 18K | |
| Chapin, Alfred P.pdf | 2025-09-04 15:23 | 15K | |
| Chapin Properties Trust &c Trustees of.pdf | 2025-09-04 15:23 | 19K | |
| Chapin-Edison Condominiums.pdf | 2025-09-04 15:23 | 20K | |
| Chapin Heights.pdf | 2025-09-04 15:23 | 25K | |
| Chapin Heights Realty Inc.pdf | 2025-09-04 15:23 | 27K | |
| Chapin Greene Inc.pdf | 2025-09-04 15:23 | 20K | |
| Chapin Greene Condominium.pdf | 2025-09-04 15:23 | 16K | |
| Chapin Center.pdf | 2025-09-04 15:23 | 17K | |
| Chapdelaine, Roger.pdf | 2025-09-04 15:23 | 18K | |
| Chapdelaine, Joseph.pdf | 2025-09-04 15:23 | 69K | |
| Chapdelaine (Joseph) Inc.pdf | 2025-09-04 15:23 | 61K | |
| Chapdelaine, Harvey.pdf | 2025-09-04 15:23 | 27K | |
| Chapdelaine, Donald R J.pdf | 2025-09-04 15:23 | 17K | |
| Chapdelaine (Joseph) & Sons.pdf | 2025-09-04 15:23 | 24K | |
| Chandler, Slope.pdf | 2025-09-04 15:23 | 16K | |
| Chapdelaine (Jos) & Sons Inc.pdf | 2025-09-04 15:23 | 18K | |
| Chandonnais, William.pdf | 2025-09-04 15:23 | 17K | |
| Chandler, Hugh K &c.pdf | 2025-09-04 15:23 | 18K | |
| Chandler, Gordon H.pdf | 2025-09-04 15:23 | 17K | |
| Champion International.pdf | 2025-09-04 15:23 | 17K | |
| Champigny, Edward R.pdf | 2025-09-04 15:23 | 24K | |
| Champiny, Stuart E.pdf | 2025-09-04 15:23 | 18K | |
| Champiny, Frances S.pdf | 2025-09-04 15:23 | 16K | |
| Champartes, John C.pdf | 2025-09-04 15:23 | 23K | |
| Champagne, Ronald.pdf | 2025-09-04 15:23 | 19K | |
| Champagne, Louise J.pdf | 2025-09-04 15:23 | 16K | |
| Champagne, Lillian R.pdf | 2025-09-04 15:23 | 18K | |
| Champagne, Joseph.pdf | 2025-09-04 15:23 | 17K | |
| Champagne, Dominque A.pdf | 2025-09-04 15:23 | 18K | |
| Champagne, Cecile M.pdf | 2025-09-04 15:23 | 16K | |
| Champagne, Bernard O.pdf | 2025-09-04 15:23 | 16K | |
| Champagne, Arthur H.pdf | 2025-09-04 15:23 | 16K | |
| Champagne, Armand.pdf | 2025-09-04 15:23 | 17K | |
| Champagne, Antoinette.pdf | 2025-09-04 15:23 | 18K | |
| Chamonix Chalet Properties Inc.pdf | 2025-09-04 15:23 | 141K | |
| Champ Development Co Inc.pdf | 2025-09-04 15:23 | 25K | |
| Champagne (A) & Sons Inc.pdf | 2025-09-04 15:23 | 16K | |
| Champagne, A.pdf | 2025-09-04 15:23 | 18K | |
| Chambers, Wayne L.pdf | 2025-09-04 15:23 | 16K | |
| Ch - Master.pdf | 2025-09-04 15:23 | 7.6M | |
| Chambers, Renee M.pdf | 2025-09-04 15:23 | 16K | |
| Chamberland, Lionel.pdf | 2025-09-04 15:23 | 25K | |
| Chambers, Chester J.pdf | 2025-09-04 15:23 | 17K | |
| Chamberlain, Everett.pdf | 2025-09-04 15:23 | 17K | |
| Chalk, Thomas J.pdf | 2025-09-04 15:23 | 18K | |
| Chamberlain, Everett N.pdf | 2025-09-04 15:23 | 18K | |
| Chamberlain, Curtis E.pdf | 2025-09-04 15:23 | 20K | |
| Chamberlain, Clifford F.pdf | 2025-09-04 15:23 | 21K | |
| Chamber of Commerce Springfield.pdf | 2025-09-04 15:23 | 21K | |
| Chalmers, Estate of James C.pdf | 2025-09-04 15:23 | 17K | |
| Chalifoux, Thomas E.pdf | 2025-09-04 15:23 | 17K | |
| Chaler, Vale.pdf | 2025-09-04 15:23 | 17K | |
| Chaler Manor.pdf | 2025-09-04 15:23 | 19K | |
| Chain Saws of New England Inc.pdf | 2025-09-04 15:23 | 17K | |
| Chaffin, Gertrude Estate.pdf | 2025-09-04 15:23 | 21K | |
| Chaffin, Rehelda.pdf | 2025-09-04 15:23 | 17K | |
| Chaffin, Gertrude B.pdf | 2025-09-04 15:23 | 17K | |
| Chaffin, Erskine E.pdf | 2025-09-04 15:23 | 17K | |
| Chaffee, Viola.pdf | 2025-09-04 15:23 | 18K | |
| Chaffee, Suzanne M.pdf | 2025-09-04 15:23 | 16K | |
| Chaffee, Robert E.pdf | 2025-09-04 15:23 | 18K | |
| Chaffee, Nelson L.pdf | 2025-09-04 15:23 | 15K | |
| Chaffee, Judith A.pdf | 2025-09-04 15:23 | 20K | |
| Chaffee, Joanne T.pdf | 2025-09-04 15:23 | 20K | |
| Chaffee, Donald P.pdf | 2025-09-04 15:23 | 19K | |
| Chaffee, Dennis B.pdf | 2025-09-04 15:23 | 20K | |
| Chaffee, Dennis A.pdf | 2025-09-04 15:23 | 16K | |
| Chaffee, Charles H.pdf | 2025-09-04 15:23 | 18K | |
| Chaffee, Alice M.pdf | 2025-09-04 15:23 | 18K | |
| Chae, Lyndo H &c.pdf | 2025-09-04 15:23 | 18K | |
| Chadwick, Raymond A.pdf | 2025-09-04 15:23 | 18K | |
| Chadderton, Thomas H.pdf | 2025-09-04 15:23 | 17K | |
| Chadderton, Eva M.pdf | 2025-09-04 15:23 | 17K | |
| Chabot, William F.pdf | 2025-09-04 15:23 | 16K | |
| Chabot, Leonard A.pdf | 2025-09-04 15:23 | 16K | |
| Chabonneau, Joseph.pdf | 2025-09-04 15:23 | 20K | |
| Chabot, Irene R.pdf | 2025-09-04 15:23 | 16K | |
|
|---|